C20H32O2 — CID 162980420
4-(6,10-dimethylundeca-2,4,6-trien-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 162980420) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 4-(6,10-dimethylundeca-2,4,6-trien-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(6,10-dimethylundeca-2,4,6-trien-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162980420 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 4-(6,10-dimethylundeca-2,4,6-trien-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C=CC=C(C)C1CCC(C(=O)O)CC1)=CCCC(C)C |
| InChI | InChI=1S/C20H32O2/c1-15(2)7-5-8-16(3)9-6-10-17(4)18-11-13-19(14-12-18)20(21)22/h6,8-10,15,18-19H,5,7,11-14H2,1-4H3,(H,21,22) |
| InChIKey | YFJCFMFCDTWZAZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|