C31H50O5 — CID 162981036
methyl 10,11-dihydroxy-1-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate (PubChem CID 162981036) has the molecular formula C31H50O5 and a molecular weight of 502.74 g/mol. Its IUPAC name is methyl 10,11-dihydroxy-1-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl 10,11-dihydroxy-1-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 162981036 |
| Molecular Formula | C31H50O5 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | methyl 10,11-dihydroxy-1-(hydroxymethyl)-2,6a,6b,9,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)C12CCC(C)C(CO)C1C1=CCC3C4(C)CC(O)C(O)C(C)(C)C4CCC3(C)C1(C)CC2 |
| InChI | InChI=1S/C31H50O5/c1-18-10-13-31(26(35)36-7)15-14-29(5)20(24(31)19(18)17-32)8-9-23-28(4)16-21(33)25(34)27(2,3)22(28)11-12-30(23,29)6/h8,18-19,21-25,32-34H,9-17H2,1-7H3 |
| InChIKey | UBXJWWRROSAZBQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|