C15H24O4 — CID 162981267
(1R,4S,7S,8R,11S)-8-hydroxy-8-(hydroxymethyl)-2,2-dimethyltricyclo[5.3.1.04,11]undecane-4-carboxylic acid (PubChem CID 162981267) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1R,4S,7S,8R,11S)-8-hydroxy-8-(hydroxymethyl)-2,2-dimethyltricyclo[5.3.1.04,11]undecane-4-carboxylic acid.
| Compound Name | (1R,4S,7S,8R,11S)-8-hydroxy-8-(hydroxymethyl)-2,2-dimethyltricyclo[5.3.1.04,11]undecane-4-carboxylic acid |
|---|---|
| PubChem CID | 162981267 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1R,4S,7S,8R,11S)-8-hydroxy-8-(hydroxymethyl)-2,2-dimethyltricyclo[5.3.1.04,11]undecane-4-carboxylic acid |
| SMILES | CC1(C)C[C@@]2(C(=O)O)CC[C@H]3[C@@H]2[C@H]1CC[C@]3(O)CO |
| InChI | InChI=1S/C15H24O4/c1-13(2)7-14(12(17)18)5-3-10-11(14)9(13)4-6-15(10,19)8-16/h9-11,16,19H,3-8H2,1-2H3,(H,17,18)/t9-,10+,11+,14+,15+/m1/s1 |
| InChIKey | DFHURQMGOXKZSE-SHTIJGAHSA-N |
| XLogP | 1.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |