C30H36O3 — CID 162981334
(1R,2S,14R,15S,17R)-1,5,10,14,17,22-hexamethyl-7,20-dioxahexacyclo[13.10.1.02,14.04,8.016,25.019,23]hexacosa-4(8),5,10,16(25),19(23),21-hexaen-3-one (PubChem CID 162981334) has the molecular formula C30H36O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is (1R,2S,14R,15S,17R)-1,5,10,14,17,22-hexamethyl-7,20-dioxahexacyclo[13.10.1.02,14.04,8.016,25.019,23]hexacosa-4(8),5,10,16(25),19(23),21-hexaen-3-one.
| Compound Name | (1R,2S,14R,15S,17R)-1,5,10,14,17,22-hexamethyl-7,20-dioxahexacyclo[13.10.1.02,14.04,8.016,25.019,23]hexacosa-4(8),5,10,16(25),19(23),21-hexaen-3-one |
|---|---|
| PubChem CID | 162981334 |
| Molecular Formula | C30H36O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (1R,2S,14R,15S,17R)-1,5,10,14,17,22-hexamethyl-7,20-dioxahexacyclo[13.10.1.02,14.04,8.016,25.019,23]hexacosa-4(8),5,10,16(25),19(23),21-hexaen-3-one |
| SMILES | CC1=CCC[C@]2(C)[C@@H]3C[C@@](C)(C4=C3[C@H](C)Cc3occ(C)c3C4)[C@H]2C(=O)c2c(C)coc2C1 |
| InChI | InChI=1S/C30H36O3/c1-16-8-7-9-29(5)22-13-30(6,28(29)27(31)26-19(4)15-33-24(26)10-16)21-12-20-18(3)14-32-23(20)11-17(2)25(21)22/h8,14-15,17,22,28H,7,9-13H2,1-6H3/t17-,22-,28+,29-,30+/m1/s1 |
| InChIKey | SSRDTRQCJGXMGT-IQMUECRSSA-N |
| XLogP | 7.35 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|