C23H29NO4 — CID 162981937
(1R,4S,5S,6R,9R,13S)-6-hydroxy-5,9-dimethyl-12-oxo-14-azapentacyclo[11.7.1.01,10.04,9.015,20]henicosa-15,17,19-triene-5-carboxylic acid (PubChem CID 162981937) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is (1R,4S,5S,6R,9R,13S)-6-hydroxy-5,9-dimethyl-12-oxo-14-azapentacyclo[11.7.1.01,10.04,9.015,20]henicosa-15,17,19-triene-5-carboxylic acid.
| Compound Name | (1R,4S,5S,6R,9R,13S)-6-hydroxy-5,9-dimethyl-12-oxo-14-azapentacyclo[11.7.1.01,10.04,9.015,20]henicosa-15,17,19-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 162981937 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (1R,4S,5S,6R,9R,13S)-6-hydroxy-5,9-dimethyl-12-oxo-14-azapentacyclo[11.7.1.01,10.04,9.015,20]henicosa-15,17,19-triene-5-carboxylic acid |
| SMILES | C[C@@]1(C(=O)O)[C@H](O)CC[C@]2(C)C3CC(=O)[C@@H]4C[C@@]3(CC[C@H]12)c1ccccc1N4 |
| InChI | InChI=1S/C23H29NO4/c1-21-9-8-19(26)22(2,20(27)28)17(21)7-10-23-12-15(16(25)11-18(21)23)24-14-6-4-3-5-13(14)23/h3-6,15,17-19,24,26H,7-12H2,1-2H3,(H,27,28)/t15-,17-,18?,19+,21-,22-,23-/m0/s1 |
| InChIKey | UESFHRIHCVPQCD-ZTGASFGHSA-N |
| XLogP | 3.36 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |