C22H31NO5 — CID 162982025
(1S,2S,3S,4R,6S,11R)-3-ethyl-3'-methyl-11-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]spiro[5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,5'-furan]-2'-one (PubChem CID 162982025) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is (1S,2S,3S,4R,6S,11R)-3-ethyl-3'-methyl-11-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]spiro[5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,5'-furan]-2'-one.
| Compound Name | (1S,2S,3S,4R,6S,11R)-3-ethyl-3'-methyl-11-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]spiro[5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,5'-furan]-2'-one |
|---|---|
| PubChem CID | 162982025 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (1S,2S,3S,4R,6S,11R)-3-ethyl-3'-methyl-11-[(2S,4R)-4-methyl-5-oxooxolan-2-yl]spiro[5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,5'-furan]-2'-one |
| SMILES | CC[C@H]1[C@@H]2[C@H](CCCN3[C@@H]([C@@H]4C[C@@H](C)C(=O)O4)CC[C@@H]23)O[C@]12C=C(C)C(=O)O2 |
| InChI | InChI=1S/C22H31NO5/c1-4-14-19-16-8-7-15(18-10-12(2)20(24)26-18)23(16)9-5-6-17(19)27-22(14)11-13(3)21(25)28-22/h11-12,14-19H,4-10H2,1-3H3/t12-,14+,15-,16+,17+,18+,19+,22+/m1/s1 |
| InChIKey | UINUUSQOLRQGNF-BDHPXFNWSA-N |
| XLogP | 2.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |