C25H22O7 — CID 162982165
1-[(2R,3S)-2-(3,5-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-3,4-dihydro-2H-chromen-8-yl]-3-phenylprop-2-en-1-one (PubChem CID 162982165) has the molecular formula C25H22O7 and a molecular weight of 434.44 g/mol. Its IUPAC name is 1-[(2R,3S)-2-(3,5-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-3,4-dihydro-2H-chromen-8-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[(2R,3S)-2-(3,5-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-3,4-dihydro-2H-chromen-8-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 162982165 |
| Molecular Formula | C25H22O7 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[(2R,3S)-2-(3,5-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-3,4-dihydro-2H-chromen-8-yl]-3-phenylprop-2-en-1-one |
| SMILES | COc1cc(O)c(C(=O)C=Cc2ccccc2)c2c1C[C@H](O)[C@@H](c1cc(O)cc(O)c1)O2 |
| InChI | InChI=1S/C25H22O7/c1-31-22-13-20(29)23(19(28)8-7-14-5-3-2-4-6-14)25-18(22)12-21(30)24(32-25)15-9-16(26)11-17(27)10-15/h2-11,13,21,24,26-27,29-30H,12H2,1H3/t21-,24+/m0/s1 |
| InChIKey | BARBUPBDCQNXQJ-XUZZJYLKSA-N |
| XLogP | 3.75 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|