About (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol
(1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol (PubChem CID 162982212) has the molecular formula C11H16Br2N2O2
and a molecular weight of 368.07 g/mol. Its IUPAC name is (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol.
Molecular Properties
| Compound Name | (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol |
| PubChem CID | 162982212 |
| Molecular Formula | C11H16Br2N2O2 |
| Molecular Weight | 368.07 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol |
| SMILES | NCCCOc1c(Br)cc([C@@H](O)CN)cc1Br |
| InChI | InChI=1S/C11H16Br2N2O2/c12-8-4-7(10(16)6-15)5-9(13)11(8)17-3-1-2-14/h4-5,10,16H,1-3,6,14-15H2/t10-/m0/s1 |
| InChIKey | LDAZBBKQQALEAP-JTQLQIEISA-N |
| XLogP | 1.93 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.07 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol?
The IUPAC name of (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol (CID 162982212) is (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol.
What is the SMILES notation for (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol?
The canonical SMILES for (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol is NCCCOc1c(Br)cc([C@@H](O)CN)cc1Br.
What is the InChIKey of (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol?
The InChIKey is LDAZBBKQQALEAP-JTQLQIEISA-N. The full InChI is InChI=1S/C11H16Br2N2O2/c12-8-4-7(10(16)6-15)5-9(13)11(8)17-3-1-2-14/h4-5,10,16H,1-3,6,14-15H2/t10-/m0/s1.
What are the key properties of (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol?
(1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol has a molecular weight of 368.07 g/mol, XLogP of 1.93, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-amino-1-[4-(3-aminopropoxy)-3,5-dibromophenyl]ethanol is sourced from PubChem (CID 162982212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).