C12H20O2 — CID 162982358
(3S,6S)-3,6-dimethoxy-1-methyl-4-propan-2-ylcyclohexa-1,4-diene (PubChem CID 162982358) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (3S,6S)-3,6-dimethoxy-1-methyl-4-propan-2-ylcyclohexa-1,4-diene.
| Compound Name | (3S,6S)-3,6-dimethoxy-1-methyl-4-propan-2-ylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 162982358 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3S,6S)-3,6-dimethoxy-1-methyl-4-propan-2-ylcyclohexa-1,4-diene |
| SMILES | CO[C@H]1C=C(C(C)C)[C@@H](OC)C=C1C |
| InChI | InChI=1S/C12H20O2/c1-8(2)10-7-11(13-4)9(3)6-12(10)14-5/h6-8,11-12H,1-5H3/t11-,12-/m0/s1 |
| InChIKey | FLFQAMVYBHKCNO-RYUDHWBXSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|