C18H26O11 — CID 162982633
methyl 5,7-bis(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 162982633) has the molecular formula C18H26O11 and a molecular weight of 418.40 g/mol. Its IUPAC name is methyl 5,7-bis(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl 5,7-bis(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 162982633 |
| Molecular Formula | C18H26O11 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | methyl 5,7-bis(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C2C(CO)=CC(CO)C12 |
| InChI | InChI=1S/C18H26O11/c1-26-16(25)9-6-27-17(12-8(4-20)2-7(3-19)11(9)12)29-18-15(24)14(23)13(22)10(5-21)28-18/h2,6-7,10-15,17-24H,3-5H2,1H3 |
| InChIKey | PTPQTMGOUIHFNR-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|