C15H22O4 — CID 162982663
(3R,3aR,4S,10S,11aR)-4-hydroxy-3,6,10-trimethyl-3,3a,4,5,8,10,11,11a-octahydrocyclodeca[b]furan-2,9-dione (PubChem CID 162982663) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3R,3aR,4S,10S,11aR)-4-hydroxy-3,6,10-trimethyl-3,3a,4,5,8,10,11,11a-octahydrocyclodeca[b]furan-2,9-dione.
| Compound Name | (3R,3aR,4S,10S,11aR)-4-hydroxy-3,6,10-trimethyl-3,3a,4,5,8,10,11,11a-octahydrocyclodeca[b]furan-2,9-dione |
|---|---|
| PubChem CID | 162982663 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3R,3aR,4S,10S,11aR)-4-hydroxy-3,6,10-trimethyl-3,3a,4,5,8,10,11,11a-octahydrocyclodeca[b]furan-2,9-dione |
| SMILES | CC1=CCC(=O)[C@@H](C)C[C@H]2OC(=O)[C@H](C)[C@@H]2[C@@H](O)C1 |
| InChI | InChI=1S/C15H22O4/c1-8-4-5-11(16)9(2)7-13-14(12(17)6-8)10(3)15(18)19-13/h4,9-10,12-14,17H,5-7H2,1-3H3/t9-,10+,12-,13+,14+/m0/s1 |
| InChIKey | YAHBMCAACKWCEA-SZZQBSIJSA-N |
| XLogP | 1.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|