C16H27NO — CID 162983181
(2S,3R,6S)-6-deca-1,3,5-trienyl-2-methylpiperidin-3-ol (PubChem CID 162983181) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (2S,3R,6S)-6-deca-1,3,5-trienyl-2-methylpiperidin-3-ol.
| Compound Name | (2S,3R,6S)-6-deca-1,3,5-trienyl-2-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 162983181 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (2S,3R,6S)-6-deca-1,3,5-trienyl-2-methylpiperidin-3-ol |
| SMILES | CCCCC=CC=CC=C[C@@H]1CC[C@@H](O)[C@H](C)N1 |
| InChI | InChI=1S/C16H27NO/c1-3-4-5-6-7-8-9-10-11-15-12-13-16(18)14(2)17-15/h6-11,14-18H,3-5,12-13H2,1-2H3/t14-,15+,16+/m0/s1 |
| InChIKey | LSCWHIBYDGDOLC-ARFHVFGLSA-N |
| XLogP | 3.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|