C28H46O2 — CID 162983209
(3S,6S)-3-ethyl-6-[(3S,8R,9R,10S,13S,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-2-one (PubChem CID 162983209) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is (3S,6S)-3-ethyl-6-[(3S,8R,9R,10S,13S,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-2-one.
| Compound Name | (3S,6S)-3-ethyl-6-[(3S,8R,9R,10S,13S,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-2-one |
|---|---|
| PubChem CID | 162983209 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | (3S,6S)-3-ethyl-6-[(3S,8R,9R,10S,13S,14R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-2-one |
| SMILES | CCC(CC[C@H](C)[C@H]1CC[C@@H]2[C@H]3CC=C4C[C@@H](O)CC[C@@]4(C)[C@@H]3CC[C@]21C)C(C)=O |
| InChI | InChI=1S/C28H46O2/c1-6-20(19(3)29)8-7-18(2)24-11-12-25-23-10-9-21-17-22(30)13-15-27(21,4)26(23)14-16-28(24,25)5/h9,18,20,22-26,30H,6-8,10-17H2,1-5H3/t18-,20?,22-,23+,24+,25+,26+,27+,28-/m0/s1 |
| InChIKey | DMPCQZBAZOKWKU-BKXPMNFLSA-N |
| XLogP | 6.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|