C31H46O5 — CID 162983295
3-[(3S,3aS,5aR,6S,7S,9bS)-3-[(2S)-1-methoxy-6-methyl-1,4-dioxohept-5-en-2-yl]-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,5,5a,7,8-octahydrocyclopenta[a]naphthalen-6-yl]propanoic acid (PubChem CID 162983295) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is 3-[(3S,3aS,5aR,6S,7S,9bS)-3-[(2S)-1-methoxy-6-methyl-1,4-dioxohept-5-en-2-yl]-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,5,5a,7,8-octahydrocyclopenta[a]naphthalen-6-yl]propanoic acid.
| Compound Name | 3-[(3S,3aS,5aR,6S,7S,9bS)-3-[(2S)-1-methoxy-6-methyl-1,4-dioxohept-5-en-2-yl]-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,5,5a,7,8-octahydrocyclopenta[a]naphthalen-6-yl]propanoic acid |
|---|---|
| PubChem CID | 162983295 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 3-[(3S,3aS,5aR,6S,7S,9bS)-3-[(2S)-1-methoxy-6-methyl-1,4-dioxohept-5-en-2-yl]-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,5,5a,7,8-octahydrocyclopenta[a]naphthalen-6-yl]propanoic acid |
| SMILES | C=C(C)[C@@H]1CC=C2[C@H](CC[C@@]3(C)[C@H]([C@H](CC(=O)C=C(C)C)C(=O)OC)CC[C@]23C)[C@@]1(C)CCC(=O)O |
| InChI | InChI=1S/C31H46O5/c1-19(2)17-21(32)18-22(28(35)36-8)24-11-15-31(7)26-10-9-23(20(3)4)29(5,14-13-27(33)34)25(26)12-16-30(24,31)6/h10,17,22-25H,3,9,11-16,18H2,1-2,4-8H3,(H,33,34)/t22-,23-,24-,25-,29-,30-,31+/m0/s1 |
| InChIKey | DAQCFFGRXTVWBG-MMOXWZNWSA-N |
| XLogP | 6.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|