C37H54O2 — CID 162983516
phenyl (3S,4aR,6aS,6bS,8aR,11S,12R,12aS,14aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-3-carboxylate (PubChem CID 162983516) has the molecular formula C37H54O2 and a molecular weight of 530.84 g/mol. Its IUPAC name is phenyl (3S,4aR,6aS,6bS,8aR,11S,12R,12aS,14aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-3-carboxylate.
| Compound Name | phenyl (3S,4aR,6aS,6bS,8aR,11S,12R,12aS,14aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-3-carboxylate |
|---|---|
| PubChem CID | 162983516 |
| Molecular Formula | C37H54O2 |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.41 |
| IUPAC Name | phenyl (3S,4aR,6aS,6bS,8aR,11S,12R,12aS,14aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-3-carboxylate |
| SMILES | C[C@@H]1[C@@H](C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](C(=O)Oc6ccccc6)C(C)(C)[C@H]5CC[C@@]43C)[C@@H]12 |
| InChI | InChI=1S/C37H54O2/c1-24-16-19-34(5)22-23-36(7)27(31(34)25(24)2)14-15-30-35(6)20-17-28(32(38)39-26-12-10-9-11-13-26)33(3,4)29(35)18-21-37(30,36)8/h9-14,24-25,28-31H,15-23H2,1-8H3/t24-,25+,28+,29+,30+,31+,34+,35-,36+,37-/m0/s1 |
| InChIKey | ZCZRNQNHDTYINX-ZAKFAGTBSA-N |
| XLogP | 9.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|