C30H50O4 — CID 162983645
(6S,8R,10S,11R,12S,15R,16R)-15-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-7,7,12,16-tetramethyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-diene-6,10-diol (PubChem CID 162983645) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is (6S,8R,10S,11R,12S,15R,16R)-15-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-7,7,12,16-tetramethyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-diene-6,10-diol.
| Compound Name | (6S,8R,10S,11R,12S,15R,16R)-15-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-7,7,12,16-tetramethyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-diene-6,10-diol |
|---|---|
| PubChem CID | 162983645 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (6S,8R,10S,11R,12S,15R,16R)-15-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-7,7,12,16-tetramethyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),3-diene-6,10-diol |
| SMILES | C[C@H](CC[C@@H](O)C(C)(C)O)[C@H]1CC[C@@]2(C)[C@H]3C(=CC[C@]12C)CC1=CC[C@H](O)C(C)(C)[C@@H]1C[C@@H]3O |
| InChI | InChI=1S/C30H50O4/c1-18(8-10-25(33)28(4,5)34)21-13-15-30(7)26-20(12-14-29(21,30)6)16-19-9-11-24(32)27(2,3)22(19)17-23(26)31/h9,12,18,21-26,31-34H,8,10-11,13-17H2,1-7H3/t18-,21-,22-,23+,24+,25-,26+,29-,30+/m1/s1 |
| InChIKey | BZTFJJJLTMNMRP-SKTQJWIJSA-N |
| XLogP | 5.39 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|