C15H12O4 — CID 162983961
[(2E,5R,9S)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]nona-3,7-dien-9-yl] acetate (PubChem CID 162983961) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is [(2E,5R,9S)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]nona-3,7-dien-9-yl] acetate.
| Compound Name | [(2E,5R,9S)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]nona-3,7-dien-9-yl] acetate |
|---|---|
| PubChem CID | 162983961 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | [(2E,5R,9S)-2-hexa-2,4-diynylidene-1,6-dioxaspiro[4.4]nona-3,7-dien-9-yl] acetate |
| SMILES | CC#CC#C/C=C1\C=C[C@@]2(OC=C[C@@H]2OC(C)=O)O1 |
| InChI | InChI=1S/C15H12O4/c1-3-4-5-6-7-13-8-10-15(19-13)14(9-11-17-15)18-12(2)16/h7-11,14H,1-2H3/b13-7+/t14-,15+/m0/s1 |
| InChIKey | XQVRVLVORPSYNU-GEJCVMBQSA-N |
| XLogP | 1.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|