About CID 162984525
CID 162984525 (PubChem CID 162984525) has the molecular formula C21H30O6
and a molecular weight of 378.47 g/mol.
Molecular Properties
| Compound Name | CID 162984525 |
| PubChem CID | 162984525 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | — |
| SMILES | CO[C@@H]1C[C@@]2(CC[C@]3(O2)[C@@H](C)C[C@@H]2OC(=O)[C@]4(C)CCC[C@]3(C)[C@H]24)C(=O)O1 |
| InChI | InChI=1S/C21H30O6/c1-12-10-13-15-18(2,16(22)25-13)6-5-7-19(15,3)21(12)9-8-20(27-21)11-14(24-4)26-17(20)23/h12-15H,5-11H2,1-4H3/t12-,13-,14-,15+,18+,19+,20-,21-/m0/s1 |
| InChIKey | NTKKRFQRYGKWKB-OPMVAEBFSA-N |
| XLogP | 2.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 162984525 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162984525?
The IUPAC name of CID 162984525 (CID 162984525) is not available.
What is the SMILES notation for CID 162984525?
The canonical SMILES for CID 162984525 is CO[C@@H]1C[C@@]2(CC[C@]3(O2)[C@@H](C)C[C@@H]2OC(=O)[C@]4(C)CCC[C@]3(C)[C@H]24)C(=O)O1.
What is the InChIKey of CID 162984525?
The InChIKey is NTKKRFQRYGKWKB-OPMVAEBFSA-N. The full InChI is InChI=1S/C21H30O6/c1-12-10-13-15-18(2,16(22)25-13)6-5-7-19(15,3)21(12)9-8-20(27-21)11-14(24-4)26-17(20)23/h12-15H,5-11H2,1-4H3/t12-,13-,14-,15+,18+,19+,20-,21-/m0/s1.
What are the key properties of CID 162984525?
CID 162984525 has a molecular weight of 378.47 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162984525 is sourced from PubChem (CID 162984525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).