C25H34O6 — CID 162984538
[(3R,3aS,4S,8R,8aS)-8-acetyloxy-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] 4-methoxybenzoate (PubChem CID 162984538) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(3R,3aS,4S,8R,8aS)-8-acetyloxy-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] 4-methoxybenzoate.
| Compound Name | [(3R,3aS,4S,8R,8aS)-8-acetyloxy-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 162984538 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(3R,3aS,4S,8R,8aS)-8-acetyloxy-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H]2CC(C)=C[C@@H](OC(C)=O)[C@@]3(C)CC[C@@](O)(C(C)C)[C@H]23)cc1 |
| InChI | InChI=1S/C25H34O6/c1-15(2)25(28)12-11-24(5)21(30-17(4)26)14-16(3)13-20(22(24)25)31-23(27)18-7-9-19(29-6)10-8-18/h7-10,14-15,20-22,28H,11-13H2,1-6H3/t20-,21+,22+,24+,25+/m0/s1 |
| InChIKey | OXKMNBITZDQOOE-FSHOYSFVSA-N |
| XLogP | 4.31 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|