C13H18O6 — CID 162984693
[(1R,5R)-5-hydroxy-4-methoxy-5-methyl-2,6-dioxocyclohex-3-en-1-yl] (2R)-2-methylbutanoate (PubChem CID 162984693) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is [(1R,5R)-5-hydroxy-4-methoxy-5-methyl-2,6-dioxocyclohex-3-en-1-yl] (2R)-2-methylbutanoate.
| Compound Name | [(1R,5R)-5-hydroxy-4-methoxy-5-methyl-2,6-dioxocyclohex-3-en-1-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162984693 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [(1R,5R)-5-hydroxy-4-methoxy-5-methyl-2,6-dioxocyclohex-3-en-1-yl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)O[C@@H]1C(=O)C=C(OC)[C@@](C)(O)C1=O |
| InChI | InChI=1S/C13H18O6/c1-5-7(2)12(16)19-10-8(14)6-9(18-4)13(3,17)11(10)15/h6-7,10,17H,5H2,1-4H3/t7-,10-,13-/m1/s1 |
| InChIKey | JWUYCQNPNLREFR-XBURVNOZSA-N |
| XLogP | 0.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|