C20H30O4 — CID 162984819
(1S,2R,8Z,11Z,14Z,16R,17S,18S)-2-ethyl-17,18-dihydroxy-3-oxabicyclo[14.3.0]nonadeca-8,11,14-trien-4-one (PubChem CID 162984819) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2R,8Z,11Z,14Z,16R,17S,18S)-2-ethyl-17,18-dihydroxy-3-oxabicyclo[14.3.0]nonadeca-8,11,14-trien-4-one.
| Compound Name | (1S,2R,8Z,11Z,14Z,16R,17S,18S)-2-ethyl-17,18-dihydroxy-3-oxabicyclo[14.3.0]nonadeca-8,11,14-trien-4-one |
|---|---|
| PubChem CID | 162984819 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,2R,8Z,11Z,14Z,16R,17S,18S)-2-ethyl-17,18-dihydroxy-3-oxabicyclo[14.3.0]nonadeca-8,11,14-trien-4-one |
| SMILES | CC[C@H]1OC(=O)CCC/C=C\C/C=C\C/C=C\[C@H]2[C@H](O)[C@@H](O)C[C@@H]21 |
| InChI | InChI=1S/C20H30O4/c1-2-18-16-14-17(21)20(23)15(16)12-10-8-6-4-3-5-7-9-11-13-19(22)24-18/h4-7,10,12,15-18,20-21,23H,2-3,8-9,11,13-14H2,1H3/b6-4-,7-5-,12-10-/t15-,16+,17+,18-,20+/m1/s1 |
| InChIKey | HBSDDNICWLARIO-POYOQXDYSA-N |
| XLogP | 3.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|