C28H36O5 — CID 162984872
(2R)-2-[(1R)-1-hydroxy-1-[(9R,10R,13R,16R,17R)-16-hydroxy-10,13-dimethyl-1-oxo-4,7,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one (PubChem CID 162984872) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is (2R)-2-[(1R)-1-hydroxy-1-[(9R,10R,13R,16R,17R)-16-hydroxy-10,13-dimethyl-1-oxo-4,7,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1R)-1-hydroxy-1-[(9R,10R,13R,16R,17R)-16-hydroxy-10,13-dimethyl-1-oxo-4,7,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 162984872 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (2R)-2-[(1R)-1-hydroxy-1-[(9R,10R,13R,16R,17R)-16-hydroxy-10,13-dimethyl-1-oxo-4,7,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
| SMILES | CC1=C(C)C(=O)O[C@@H]([C@](C)(O)[C@H]2[C@H](O)CC3=C4CC=C5CC=CC(=O)[C@]5(C)[C@@H]4CC[C@@]32C)C1 |
| InChI | InChI=1S/C28H36O5/c1-15-13-23(33-25(31)16(15)2)28(5,32)24-21(29)14-20-18-10-9-17-7-6-8-22(30)27(17,4)19(18)11-12-26(20,24)3/h6,8-9,19,21,23-24,29,32H,7,10-14H2,1-5H3/t19-,21-,23-,24+,26+,27+,28+/m1/s1 |
| InChIKey | RXBMJLOBDBSDOF-CRPGMMHLSA-N |
| XLogP | 4.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|