C24H34O4 — CID 162985008
(3Z,5E,8S,9E,11Z,19E,24R)-8-hydroxy-24-methyl-1-oxacyclotetracosa-3,5,9,11,19-pentaene-2,16-dione (PubChem CID 162985008) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is (3Z,5E,8S,9E,11Z,19E,24R)-8-hydroxy-24-methyl-1-oxacyclotetracosa-3,5,9,11,19-pentaene-2,16-dione.
| Compound Name | (3Z,5E,8S,9E,11Z,19E,24R)-8-hydroxy-24-methyl-1-oxacyclotetracosa-3,5,9,11,19-pentaene-2,16-dione |
|---|---|
| PubChem CID | 162985008 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (3Z,5E,8S,9E,11Z,19E,24R)-8-hydroxy-24-methyl-1-oxacyclotetracosa-3,5,9,11,19-pentaene-2,16-dione |
| SMILES | C[C@@H]1CCC/C=C/CCC(=O)CCC/C=C\C=C\[C@@H](O)C/C=C/C=C\C(=O)O1 |
| InChI | InChI=1S/C24H34O4/c1-21-15-9-4-2-5-10-16-22(25)17-11-6-3-7-12-18-23(26)19-13-8-14-20-24(27)28-21/h2-3,5,7-8,12-14,18,20-21,23,26H,4,6,9-11,15-17,19H2,1H3/b5-2+,7-3-,13-8+,18-12+,20-14-/t21-,23-/m1/s1 |
| InChIKey | RSTZNFQDRKJJEI-ZOSCFRLCSA-N |
| XLogP | 5.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|