About (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol
(3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol (PubChem CID 162985110) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol.
Molecular Properties
| Compound Name | (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol |
| PubChem CID | 162985110 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol |
| SMILES | C=C1c2ccccc2N=C2[C@H](O)CCN12 |
| InChI | InChI=1S/C12H12N2O/c1-8-9-4-2-3-5-10(9)13-12-11(15)6-7-14(8)12/h2-5,11,15H,1,6-7H2/t11-/m1/s1 |
| InChIKey | VZMMDLXOQXIQHD-LLVKDONJSA-N |
| XLogP | 1.77 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol?
The IUPAC name of (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol (CID 162985110) is (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol.
What is the SMILES notation for (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol?
The canonical SMILES for (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol is C=C1c2ccccc2N=C2[C@H](O)CCN12.
What is the InChIKey of (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol?
The InChIKey is VZMMDLXOQXIQHD-LLVKDONJSA-N. The full InChI is InChI=1S/C12H12N2O/c1-8-9-4-2-3-5-10(9)13-12-11(15)6-7-14(8)12/h2-5,11,15H,1,6-7H2/t11-/m1/s1.
What are the key properties of (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol?
(3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol has a molecular weight of 200.24 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-9-methylidene-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-3-ol is sourced from PubChem (CID 162985110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).