C31H50O4 — CID 162985119
1-(7,9,10-trihydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)ethanone (PubChem CID 162985119) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is 1-(7,9,10-trihydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)ethanone.
| Compound Name | 1-(7,9,10-trihydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)ethanone |
|---|---|
| PubChem CID | 162985119 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | 1-(7,9,10-trihydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)ethanone |
| SMILES | C=C(C)C1CCC2(C(C)=O)CCC3(C)C(CCC4C5(C)CC(O)C(O)C(C)(C)C5C(O)CC43C)C12 |
| InChI | InChI=1S/C31H50O4/c1-17(2)19-11-12-31(18(3)32)14-13-29(7)20(24(19)31)9-10-23-28(6)15-22(34)26(35)27(4,5)25(28)21(33)16-30(23,29)8/h19-26,33-35H,1,9-16H2,2-8H3 |
| InChIKey | PSAGZAKKBRJWQF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|