C10H22O4 — CID 162985638
(2S,3R,6S)-3,7-dimethyloctane-1,2,6,7-tetrol (PubChem CID 162985638) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is (2S,3R,6S)-3,7-dimethyloctane-1,2,6,7-tetrol.
| Compound Name | (2S,3R,6S)-3,7-dimethyloctane-1,2,6,7-tetrol |
|---|---|
| PubChem CID | 162985638 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (2S,3R,6S)-3,7-dimethyloctane-1,2,6,7-tetrol |
| SMILES | C[C@H](CC[C@H](O)C(C)(C)O)[C@H](O)CO |
| InChI | InChI=1S/C10H22O4/c1-7(8(12)6-11)4-5-9(13)10(2,3)14/h7-9,11-14H,4-6H2,1-3H3/t7-,8-,9+/m1/s1 |
| InChIKey | UZTSPRWBSITKRZ-HLTSFMKQSA-N |
| XLogP | -0.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |