C17H30O3 — CID 162985652
2-(5-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)propyl acetate (PubChem CID 162985652) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 2-(5-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)propyl acetate.
| Compound Name | 2-(5-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)propyl acetate |
|---|---|
| PubChem CID | 162985652 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-(5-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)propyl acetate |
| SMILES | CC(=O)OCC(C)C1CCC2(C)C(O)CCC(C)C2C1 |
| InChI | InChI=1S/C17H30O3/c1-11-5-6-16(19)17(4)8-7-14(9-15(11)17)12(2)10-20-13(3)18/h11-12,14-16,19H,5-10H2,1-4H3 |
| InChIKey | MPYAAOSXDGLKOJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |