C19H33N3O2 — CID 162985884
(2R)-9-acetyl-2-[(1Z,4E)-hepta-1,4-dienyl]-1,5,9-triazacyclotridecan-4-one (PubChem CID 162985884) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is (2R)-9-acetyl-2-[(1Z,4E)-hepta-1,4-dienyl]-1,5,9-triazacyclotridecan-4-one.
| Compound Name | (2R)-9-acetyl-2-[(1Z,4E)-hepta-1,4-dienyl]-1,5,9-triazacyclotridecan-4-one |
|---|---|
| PubChem CID | 162985884 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | (2R)-9-acetyl-2-[(1Z,4E)-hepta-1,4-dienyl]-1,5,9-triazacyclotridecan-4-one |
| SMILES | CC/C=C/C/C=C\[C@H]1CC(=O)NCCCN(C(C)=O)CCCCN1 |
| InChI | InChI=1S/C19H33N3O2/c1-3-4-5-6-7-11-18-16-19(24)21-13-10-15-22(17(2)23)14-9-8-12-20-18/h4-5,7,11,18,20H,3,6,8-10,12-16H2,1-2H3,(H,21,24)/b5-4+,11-7-/t18-/m0/s1 |
| InChIKey | XNQNGMLBSCADES-DYTJBYSWSA-N |
| XLogP | 2.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|