C11H19NO — CID 162985984
(4R,6R,7S,7aS)-2,4,7-trimethyl-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridin-6-ol (PubChem CID 162985984) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (4R,6R,7S,7aS)-2,4,7-trimethyl-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridin-6-ol.
| Compound Name | (4R,6R,7S,7aS)-2,4,7-trimethyl-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridin-6-ol |
|---|---|
| PubChem CID | 162985984 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4R,6R,7S,7aS)-2,4,7-trimethyl-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridin-6-ol |
| SMILES | C[C@H]1[C@@H]2CN(C)C[C@H](C)C2=C[C@@H]1O |
| InChI | InChI=1S/C11H19NO/c1-7-5-12(3)6-10-8(2)11(13)4-9(7)10/h4,7-8,10-11,13H,5-6H2,1-3H3/t7-,8-,10-,11-/m0/s1 |
| InChIKey | PMOIEWXMDSFOBY-UUTMEEIUSA-N |
| XLogP | 1.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|