C14H20O2 — CID 162987298
(3Z,5E,7E,9E,11S)-4-hydroxy-11-methyltrideca-3,5,7,9-tetraen-2-one (PubChem CID 162987298) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (3Z,5E,7E,9E,11S)-4-hydroxy-11-methyltrideca-3,5,7,9-tetraen-2-one.
| Compound Name | (3Z,5E,7E,9E,11S)-4-hydroxy-11-methyltrideca-3,5,7,9-tetraen-2-one |
|---|---|
| PubChem CID | 162987298 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (3Z,5E,7E,9E,11S)-4-hydroxy-11-methyltrideca-3,5,7,9-tetraen-2-one |
| SMILES | CC[C@H](C)/C=C/C=C/C=C/C(O)=C/C(C)=O |
| InChI | InChI=1S/C14H20O2/c1-4-12(2)9-7-5-6-8-10-14(16)11-13(3)15/h5-12,16H,4H2,1-3H3/b6-5+,9-7+,10-8+,14-11-/t12-/m0/s1 |
| InChIKey | MREIRTWZXYCJLD-KQAYGNDXSA-N |
| XLogP | 3.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|