C11H18N2O2 — CID 162987928
(3R,8aR)-3-(2-methylpropyl)-1,3,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-2,5-dione (PubChem CID 162987928) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (3R,8aR)-3-(2-methylpropyl)-1,3,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-2,5-dione.
| Compound Name | (3R,8aR)-3-(2-methylpropyl)-1,3,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-2,5-dione |
|---|---|
| PubChem CID | 162987928 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (3R,8aR)-3-(2-methylpropyl)-1,3,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-2,5-dione |
| SMILES | CC(C)C[C@@H]1C(=O)N[C@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)12-9-4-3-5-10(14)13(8)9/h7-9H,3-6H2,1-2H3,(H,12,15)/t8-,9-/m1/s1 |
| InChIKey | NKUPVYWGJGYSJH-RKDXNWHRSA-N |
| XLogP | 0.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |