C18H24O2 — CID 162988017
1-(2-methylpropoxy)tetradeca-6,12-dien-8,10-diyn-3-one (PubChem CID 162988017) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(2-methylpropoxy)tetradeca-6,12-dien-8,10-diyn-3-one.
| Compound Name | 1-(2-methylpropoxy)tetradeca-6,12-dien-8,10-diyn-3-one |
|---|---|
| PubChem CID | 162988017 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-(2-methylpropoxy)tetradeca-6,12-dien-8,10-diyn-3-one |
| SMILES | CC=CC#CC#CC=CCCC(=O)CCOCC(C)C |
| InChI | InChI=1S/C18H24O2/c1-4-5-6-7-8-9-10-11-12-13-18(19)14-15-20-16-17(2)3/h4-5,10-11,17H,12-16H2,1-3H3 |
| InChIKey | NWBBFKZMHPILQS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|