C20H32O2 — CID 162988254
(2S,3E,8R,11R)-8-hydroxy-11-methyl-7-methylidene-4-propan-2-yl-2-prop-1-en-2-ylcyclododec-3-en-1-one (PubChem CID 162988254) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (2S,3E,8R,11R)-8-hydroxy-11-methyl-7-methylidene-4-propan-2-yl-2-prop-1-en-2-ylcyclododec-3-en-1-one.
| Compound Name | (2S,3E,8R,11R)-8-hydroxy-11-methyl-7-methylidene-4-propan-2-yl-2-prop-1-en-2-ylcyclododec-3-en-1-one |
|---|---|
| PubChem CID | 162988254 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2S,3E,8R,11R)-8-hydroxy-11-methyl-7-methylidene-4-propan-2-yl-2-prop-1-en-2-ylcyclododec-3-en-1-one |
| SMILES | C=C(C)[C@@H]1/C=C(/C(C)C)CCC(=C)[C@H](O)CC[C@@H](C)CC1=O |
| InChI | InChI=1S/C20H32O2/c1-13(2)17-9-8-16(6)19(21)10-7-15(5)11-20(22)18(12-17)14(3)4/h12-13,15,18-19,21H,3,6-11H2,1-2,4-5H3/b17-12+/t15-,18+,19-/m1/s1 |
| InChIKey | REFJEYFBFSQPJB-JXNWWVAQSA-N |
| XLogP | 4.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|