C18H26O3 — CID 162988477
[(1S,5R,6S,8R,11R)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] propanoate (PubChem CID 162988477) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is [(1S,5R,6S,8R,11R)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] propanoate.
| Compound Name | [(1S,5R,6S,8R,11R)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] propanoate |
|---|---|
| PubChem CID | 162988477 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [(1S,5R,6S,8R,11R)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] propanoate |
| SMILES | CCC(=O)O[C@H]1C(C)(C)[C@@H]2CC[C@@H](C)[C@]23C=CC(=O)[C@@]13C |
| InChI | InChI=1S/C18H26O3/c1-6-14(20)21-15-16(3,4)12-8-7-11(2)18(12)10-9-13(19)17(15,18)5/h9-12,15H,6-8H2,1-5H3/t11-,12+,15+,17+,18-/m1/s1 |
| InChIKey | UQBJIKWYBDZGLN-WQJAUYSESA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |