C20H28O7S — CID 162988900
[(3aR,4R,6Z,8R,10E,11aS)-8-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (2S,3S)-2-hydroxy-2-(hydroxymethyl)-3-sulfanylbutanoate (PubChem CID 162988900) has the molecular formula C20H28O7S and a molecular weight of 412.50 g/mol. Its IUPAC name is [(3aR,4R,6Z,8R,10E,11aS)-8-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (2S,3S)-2-hydroxy-2-(hydroxymethyl)-3-sulfanylbutanoate.
| Compound Name | [(3aR,4R,6Z,8R,10E,11aS)-8-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (2S,3S)-2-hydroxy-2-(hydroxymethyl)-3-sulfanylbutanoate |
|---|---|
| PubChem CID | 162988900 |
| Molecular Formula | C20H28O7S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [(3aR,4R,6Z,8R,10E,11aS)-8-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (2S,3S)-2-hydroxy-2-(hydroxymethyl)-3-sulfanylbutanoate |
| SMILES | C=C1C(=O)O[C@H]2/C=C(\C)C[C@@H](O)/C=C(/C)C[C@@H](OC(=O)[C@@](O)(CO)[C@H](C)S)[C@@H]12 |
| InChI | InChI=1S/C20H28O7S/c1-10-5-14(22)6-11(2)8-16(17-12(3)18(23)26-15(17)7-10)27-19(24)20(25,9-21)13(4)28/h6-7,13-17,21-22,25,28H,3,5,8-9H2,1-2,4H3/b10-7+,11-6-/t13-,14+,15-,16+,17-,20+/m0/s1 |
| InChIKey | VLJMGJBBVNUYSJ-HNMMOXNSSA-N |
| XLogP | 1.09 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|