C19H28O3 — CID 162989891
(1aS,3aS,4S,7aR,7bS,9aS)-4-hydroxy-4,7a-dimethyl-9a-propan-2-yl-1a,3a,5,6,7,7b,8,9-octahydrophenanthro[1,2-b]oxiren-3-one (PubChem CID 162989891) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1aS,3aS,4S,7aR,7bS,9aS)-4-hydroxy-4,7a-dimethyl-9a-propan-2-yl-1a,3a,5,6,7,7b,8,9-octahydrophenanthro[1,2-b]oxiren-3-one.
| Compound Name | (1aS,3aS,4S,7aR,7bS,9aS)-4-hydroxy-4,7a-dimethyl-9a-propan-2-yl-1a,3a,5,6,7,7b,8,9-octahydrophenanthro[1,2-b]oxiren-3-one |
|---|---|
| PubChem CID | 162989891 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1aS,3aS,4S,7aR,7bS,9aS)-4-hydroxy-4,7a-dimethyl-9a-propan-2-yl-1a,3a,5,6,7,7b,8,9-octahydrophenanthro[1,2-b]oxiren-3-one |
| SMILES | CC(C)[C@@]12CC[C@@H]3C(=CC(=O)[C@H]4[C@]3(C)CCC[C@]4(C)O)[C@@H]1O2 |
| InChI | InChI=1S/C19H28O3/c1-11(2)19-9-6-13-12(16(19)22-19)10-14(20)15-17(13,3)7-5-8-18(15,4)21/h10-11,13,15-16,21H,5-9H2,1-4H3/t13-,15+,16+,17-,18+,19+/m1/s1 |
| InChIKey | UPGREHAFOATQFI-IWCDAZGSSA-N |
| XLogP | 3.26 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|