C12H20O8 — CID 162989930
(3R)-4,4-dimethyl-3-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-one (PubChem CID 162989930) has the molecular formula C12H20O8 and a molecular weight of 292.28 g/mol. Its IUPAC name is (3R)-4,4-dimethyl-3-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-one.
| Compound Name | (3R)-4,4-dimethyl-3-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-one |
|---|---|
| PubChem CID | 162989930 |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (3R)-4,4-dimethyl-3-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-one |
| SMILES | CC1(C)COC(=O)[C@@H]1OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20O8/c1-12(2)4-19-11(17)9(12)18-3-5-6(13)7(14)8(15)10(16)20-5/h5-10,13-16H,3-4H2,1-2H3/t5-,6-,7+,8-,9+,10-/m1/s1 |
| InChIKey | GDSQVKRZOYJXNE-WJACCPHDSA-N |
| XLogP | -2.25 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |