C20H32O4 — CID 162990736
(1R,3S,5S,8S,10S,13R,16R)-14-(2-hydroxypropan-2-yl)-1,5,10-trimethyl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-en-16-ol (PubChem CID 162990736) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1R,3S,5S,8S,10S,13R,16R)-14-(2-hydroxypropan-2-yl)-1,5,10-trimethyl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-en-16-ol.
| Compound Name | (1R,3S,5S,8S,10S,13R,16R)-14-(2-hydroxypropan-2-yl)-1,5,10-trimethyl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-en-16-ol |
|---|---|
| PubChem CID | 162990736 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1R,3S,5S,8S,10S,13R,16R)-14-(2-hydroxypropan-2-yl)-1,5,10-trimethyl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-en-16-ol |
| SMILES | CC(C)(O)C1=C[C@@H](O)[C@]2(C)C[C@@H]3O[C@@]3(C)CC[C@@H]3O[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C20H32O4/c1-17(2,22)13-10-14(21)18(3)11-16-20(5,24-16)9-7-15-19(4,23-15)8-6-12(13)18/h10,12,14-16,21-22H,6-9,11H2,1-5H3/t12-,14+,15-,16-,18+,19-,20-/m0/s1 |
| InChIKey | DWWWEHGHMIJMAX-VRPNIUJZSA-N |
| XLogP | 2.96 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|