C15H24O8 — CID 162991356
[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(2-methylpropanoyloxy)oxan-3-yl] 2-methylbut-2-enoate (PubChem CID 162991356) has the molecular formula C15H24O8 and a molecular weight of 332.35 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(2-methylpropanoyloxy)oxan-3-yl] 2-methylbut-2-enoate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(2-methylpropanoyloxy)oxan-3-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162991356 |
| Molecular Formula | C15H24O8 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(2-methylpropanoyloxy)oxan-3-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@H]1[C@H](OC(=O)C(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H24O8/c1-5-8(4)14(20)22-12-11(18)10(17)9(6-16)21-15(12)23-13(19)7(2)3/h5,7,9-12,15-18H,6H2,1-4H3/t9-,10-,11+,12-,15+/m1/s1 |
| InChIKey | DSTHABZRTODZRO-OVKLUEDNSA-N |
| XLogP | -0.50 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|