C22H30O7 — CID 162992246
methyl (1S,2R,4aS,8aS)-7-[(2S)-1-methoxy-1-oxopropan-2-yl]-8a-methyl-2-[(Z)-2-methylbut-2-enoyl]oxy-6-oxo-1,2,3,4,4a,5-hexahydronaphthalene-1-carboxylate (PubChem CID 162992246) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl (1S,2R,4aS,8aS)-7-[(2S)-1-methoxy-1-oxopropan-2-yl]-8a-methyl-2-[(Z)-2-methylbut-2-enoyl]oxy-6-oxo-1,2,3,4,4a,5-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1S,2R,4aS,8aS)-7-[(2S)-1-methoxy-1-oxopropan-2-yl]-8a-methyl-2-[(Z)-2-methylbut-2-enoyl]oxy-6-oxo-1,2,3,4,4a,5-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 162992246 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | methyl (1S,2R,4aS,8aS)-7-[(2S)-1-methoxy-1-oxopropan-2-yl]-8a-methyl-2-[(Z)-2-methylbut-2-enoyl]oxy-6-oxo-1,2,3,4,4a,5-hexahydronaphthalene-1-carboxylate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1CC[C@H]2CC(=O)C([C@H](C)C(=O)OC)=C[C@@]2(C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C22H30O7/c1-7-12(2)19(24)29-17-9-8-14-10-16(23)15(13(3)20(25)27-5)11-22(14,4)18(17)21(26)28-6/h7,11,13-14,17-18H,8-10H2,1-6H3/b12-7-/t13-,14-,17+,18-,22+/m0/s1 |
| InChIKey | DDHBCBRLTQJJBD-WLWNZRTJSA-N |
| XLogP | 2.78 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|