C11H20O6S — CID 162992486
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S)-thian-3-yl]oxyoxane-3,4,5-triol (PubChem CID 162992486) has the molecular formula C11H20O6S and a molecular weight of 280.34 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S)-thian-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S)-thian-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 162992486 |
| Molecular Formula | C11H20O6S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S)-thian-3-yl]oxyoxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2CCCSC2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20O6S/c12-4-7-8(13)9(14)10(15)11(17-7)16-6-2-1-3-18-5-6/h6-15H,1-5H2/t6-,7+,8+,9-,10+,11+/m0/s1 |
| InChIKey | FGCBPQOUONXDAL-OVHRRVLLSA-N |
| XLogP | -1.30 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |