C21H30O7 — CID 162992832
[(2Z,5R,6E,10E)-5-acetyloxy-3-(acetyloxymethyl)-7,11-dimethyl-12-oxododeca-2,6,10-trienyl] acetate (PubChem CID 162992832) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is [(2Z,5R,6E,10E)-5-acetyloxy-3-(acetyloxymethyl)-7,11-dimethyl-12-oxododeca-2,6,10-trienyl] acetate.
| Compound Name | [(2Z,5R,6E,10E)-5-acetyloxy-3-(acetyloxymethyl)-7,11-dimethyl-12-oxododeca-2,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 162992832 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(2Z,5R,6E,10E)-5-acetyloxy-3-(acetyloxymethyl)-7,11-dimethyl-12-oxododeca-2,6,10-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(\COC(C)=O)C[C@H](/C=C(\C)CC/C=C(\C)C=O)OC(C)=O |
| InChI | InChI=1S/C21H30O7/c1-15(7-6-8-16(2)13-22)11-21(28-19(5)25)12-20(14-27-18(4)24)9-10-26-17(3)23/h8-9,11,13,21H,6-7,10,12,14H2,1-5H3/b15-11+,16-8+,20-9-/t21-/m0/s1 |
| InChIKey | FWUMLHDMPGDCOH-OZLISMEPSA-N |
| XLogP | 3.23 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|