C20H36O4 — CID 162992918
5'-(2-hydroxyethyl)-5'-(hydroxymethyl)-3,4a,8,8-tetramethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxolane]-1-ol (PubChem CID 162992918) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 5'-(2-hydroxyethyl)-5'-(hydroxymethyl)-3,4a,8,8-tetramethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxolane]-1-ol.
| Compound Name | 5'-(2-hydroxyethyl)-5'-(hydroxymethyl)-3,4a,8,8-tetramethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxolane]-1-ol |
|---|---|
| PubChem CID | 162992918 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 5'-(2-hydroxyethyl)-5'-(hydroxymethyl)-3,4a,8,8-tetramethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxolane]-1-ol |
| SMILES | CC1CC(O)C2C(C)(C)CCCC2(C)C12CCC(CO)(CCO)O2 |
| InChI | InChI=1S/C20H36O4/c1-14-12-15(23)16-17(2,3)6-5-7-18(16,4)20(14)9-8-19(13-22,24-20)10-11-21/h14-16,21-23H,5-13H2,1-4H3 |
| InChIKey | MBCYMSZGEMPFQT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |