C15H21N — CID 162993523
(1S,9R)-1,5,12,12-tetramethyl-6-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 162993523) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (1S,9R)-1,5,12,12-tetramethyl-6-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (1S,9R)-1,5,12,12-tetramethyl-6-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 162993523 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (1S,9R)-1,5,12,12-tetramethyl-6-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | Cc1ccc2c(n1)C[C@H]1CC[C@@]2(C)C1(C)C |
| InChI | InChI=1S/C15H21N/c1-10-5-6-12-13(16-10)9-11-7-8-15(12,4)14(11,2)3/h5-6,11H,7-9H2,1-4H3/t11-,15-/m1/s1 |
| InChIKey | BGCPDKKBYLHBFS-IAQYHMDHSA-N |
| XLogP | 3.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |