C23H26N2O5 — CID 162993784
dimethyl (1S,9R,16R,21S)-4-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6,17-tetraene-2,18-dicarboxylate (PubChem CID 162993784) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is dimethyl (1S,9R,16R,21S)-4-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6,17-tetraene-2,18-dicarboxylate.
| Compound Name | dimethyl (1S,9R,16R,21S)-4-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6,17-tetraene-2,18-dicarboxylate |
|---|---|
| PubChem CID | 162993784 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | dimethyl (1S,9R,16R,21S)-4-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6,17-tetraene-2,18-dicarboxylate |
| SMILES | COC(=O)C1=C[C@@]23CCCN4CC[C@@]5(c6cccc(O)c6N(C(=O)OC)[C@]15CC2)[C@@H]43 |
| InChI | InChI=1S/C23H26N2O5/c1-29-18(27)15-13-21-7-4-11-24-12-10-22(19(21)24)14-5-3-6-16(26)17(14)25(20(28)30-2)23(15,22)9-8-21/h3,5-6,13,19,26H,4,7-12H2,1-2H3/t19-,21+,22+,23+/m0/s1 |
| InChIKey | RJXCMWHLYXRMGR-MLDBQTBOSA-N |
| XLogP | 2.72 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |