About (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol
(3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol (PubChem CID 162994434) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol.
Molecular Properties
| Compound Name | (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol |
| PubChem CID | 162994434 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol |
| SMILES | NC[C@H]1CNc2ccc(O)cc21 |
| InChI | InChI=1S/C9H12N2O/c10-4-6-5-11-9-2-1-7(12)3-8(6)9/h1-3,6,11-12H,4-5,10H2/t6-/m0/s1 |
| InChIKey | IODUMQSUUADSTG-LURJTMIESA-N |
| XLogP | 0.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol?
The IUPAC name of (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol (CID 162994434) is (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol.
What is the SMILES notation for (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol?
The canonical SMILES for (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol is NC[C@H]1CNc2ccc(O)cc21.
What is the InChIKey of (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol?
The InChIKey is IODUMQSUUADSTG-LURJTMIESA-N. The full InChI is InChI=1S/C9H12N2O/c10-4-6-5-11-9-2-1-7(12)3-8(6)9/h1-3,6,11-12H,4-5,10H2/t6-/m0/s1.
What are the key properties of (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol?
(3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol has a molecular weight of 164.21 g/mol, XLogP of 0.86, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(aminomethyl)-2,3-dihydro-1H-indol-5-ol is sourced from PubChem (CID 162994434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).