C24H34O6 — CID 162995571
[(11S,16S)-11,16-diacetyloxyoctadec-17-en-12,14-diynyl] acetate (PubChem CID 162995571) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(11S,16S)-11,16-diacetyloxyoctadec-17-en-12,14-diynyl] acetate.
| Compound Name | [(11S,16S)-11,16-diacetyloxyoctadec-17-en-12,14-diynyl] acetate |
|---|---|
| PubChem CID | 162995571 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [(11S,16S)-11,16-diacetyloxyoctadec-17-en-12,14-diynyl] acetate |
| SMILES | C=C[C@@H](C#CC#C[C@H](CCCCCCCCCCOC(C)=O)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C24H34O6/c1-5-23(29-21(3)26)16-13-14-18-24(30-22(4)27)17-12-10-8-6-7-9-11-15-19-28-20(2)25/h5,23-24H,1,6-12,15,17,19H2,2-4H3/t23-,24-/m0/s1 |
| InChIKey | BAXRFCYMORJODF-ZEQRLZLVSA-N |
| XLogP | 4.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|