C21H24N2O2 — CID 162996196
methyl (1R,4S,12S,13R,20R)-5,16-diazahexacyclo[11.6.1.11,4.04,12.06,11.016,20]henicosa-2,6,8,10-tetraene-3-carboxylate (PubChem CID 162996196) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is methyl (1R,4S,12S,13R,20R)-5,16-diazahexacyclo[11.6.1.11,4.04,12.06,11.016,20]henicosa-2,6,8,10-tetraene-3-carboxylate.
| Compound Name | methyl (1R,4S,12S,13R,20R)-5,16-diazahexacyclo[11.6.1.11,4.04,12.06,11.016,20]henicosa-2,6,8,10-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 162996196 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | methyl (1R,4S,12S,13R,20R)-5,16-diazahexacyclo[11.6.1.11,4.04,12.06,11.016,20]henicosa-2,6,8,10-tetraene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@@]23CCCN4CC[C@H]([C@H]5c6ccccc6N[C@]15C2)[C@@H]43 |
| InChI | InChI=1S/C21H24N2O2/c1-25-19(24)15-11-20-8-4-9-23-10-7-14(18(20)23)17-13-5-2-3-6-16(13)22-21(15,17)12-20/h2-3,5-6,11,14,17-18,22H,4,7-10,12H2,1H3/t14-,17-,18-,20+,21-/m1/s1 |
| InChIKey | WXVRWRIEWGWIHU-QEWHTSGOSA-N |
| XLogP | 2.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |