C17H22O5 — CID 162996209
[(3S,3aR,4S,6aR,9S,9aR,9bR)-3,9-dimethyl-6-methylidene-2,8-dioxo-3a,4,5,6a,7,9,9a,9b-octahydro-3H-azuleno[4,5-b]furan-4-yl] acetate (PubChem CID 162996209) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is [(3S,3aR,4S,6aR,9S,9aR,9bR)-3,9-dimethyl-6-methylidene-2,8-dioxo-3a,4,5,6a,7,9,9a,9b-octahydro-3H-azuleno[4,5-b]furan-4-yl] acetate.
| Compound Name | [(3S,3aR,4S,6aR,9S,9aR,9bR)-3,9-dimethyl-6-methylidene-2,8-dioxo-3a,4,5,6a,7,9,9a,9b-octahydro-3H-azuleno[4,5-b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 162996209 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [(3S,3aR,4S,6aR,9S,9aR,9bR)-3,9-dimethyl-6-methylidene-2,8-dioxo-3a,4,5,6a,7,9,9a,9b-octahydro-3H-azuleno[4,5-b]furan-4-yl] acetate |
| SMILES | C=C1C[C@H](OC(C)=O)[C@@H]2[C@H](OC(=O)[C@H]2C)[C@H]2[C@H](C)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C17H22O5/c1-7-5-13(21-10(4)18)15-9(3)17(20)22-16(15)14-8(2)12(19)6-11(7)14/h8-9,11,13-16H,1,5-6H2,2-4H3/t8-,9+,11+,13+,14+,15-,16-/m1/s1 |
| InChIKey | QBXGUKUDRCWSKF-KNFRCYCHSA-N |
| XLogP | 1.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|