C32H54O4 — CID 162996302
(5R,9R,10R,13S,14S,17S)-17-[(2S,5S)-1-ethoxy-5,6-dihydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 162996302) has the molecular formula C32H54O4 and a molecular weight of 502.78 g/mol. Its IUPAC name is (5R,9R,10R,13S,14S,17S)-17-[(2S,5S)-1-ethoxy-5,6-dihydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,9R,10R,13S,14S,17S)-17-[(2S,5S)-1-ethoxy-5,6-dihydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162996302 |
| Molecular Formula | C32H54O4 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | (5R,9R,10R,13S,14S,17S)-17-[(2S,5S)-1-ethoxy-5,6-dihydroxy-6-methylheptan-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCOC[C@@H](CC[C@H](O)C(C)(C)O)[C@@H]1CC[C@]2(C)C3=CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C32H54O4/c1-9-36-20-21(10-13-27(34)29(4,5)35)22-14-18-32(8)24-11-12-25-28(2,3)26(33)16-17-30(25,6)23(24)15-19-31(22,32)7/h11,21-23,25,27,34-35H,9-10,12-20H2,1-8H3/t21-,22+,23+,25+,27+,30-,31+,32-/m1/s1 |
| InChIKey | BNEZZBWHAWVEOO-CJAAAONHSA-N |
| XLogP | 6.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|